Compound Information | SONAR Target prediction |
Name: | Melphalan |
Unique Identifier: | LOPAC 01033 |
MolClass: | Checkout models in ver1.5 and ver1.0 |
Molecular Formula: | C13Cl2H18N2O2 |
Molecular Weight: | 287.057 g/mol |
X log p: | 8.679 (online calculus) |
Lipinksi Failures | 1 |
TPSA | 20.31 |
Hydrogen Bond Donor Count: | 0 |
Hydrogen Bond Acceptors Count: | 4 |
Rotatable Bond Count: | 8 |
Canonical Smiles: | NC(Cc1ccc(cc1)N(CCCl)CCCl)C(O)=O |
Class: | DNA Metabolism |
Action: | Intercalator |
Selectivity: | GCC |
Generic_name: | Melphalan |
Chemical_iupac_name: | 2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]-propanoic acid |
Drug_type: | Approved Drug |
Drugbank_id: | APRD00118 |
Melting_point: | 177oC |
H2o_solubility: | <0.1 g/100 mL at 22°C |
Logp: | -0.432 |
Cas_registry_number: | 148-82-3 |
Drug_category: | Antineoplastic Agents; ATC:L01AA03 |
Indication: | Used to treat cancer of the ovaries and a certain type of cancer in the bone marrow |
Pharmacology: | Melphalan is an antineoplastic in the class of alkylating agents and is used to treat various forms of cancer. Alkylating agents are so named because of their ability to add alkyl groups to many electronegative groups under conditions present in cells. They stop tumor growth by cross-linking guanine bases in DNA double-helix strands - directly attacking DNA. This makes the strands unable to uncoil and separate. As this is necessary in DNA replication, the cells can no longer divide. In addition, these drugs add methyl or other alkyl groups onto molecules where they do not belong which in turn inhibits their correct utilization by base pairing and causes a miscoding of DNA. Alkylating agents are cell cycle-nonspecific. Alkylating agents work by three different mechanisms all of which achieve the same end result - disruption of DNA function and cell death. |
Mechanism_of_action: | Alkylating agents work by three different mechanisms: 1) attachment of alkyl groups to DNA bases, resulting in the DNA being fragmented by repair enzymes in their attempts to replace the alkylated bases, preventing DNA synthesis and RNA transcription from the affected DNA, 2) DNA damage via the formation of cross-links (bonds between atoms in the DNA) which prevents DNA from being separated for synthesis or transcription, and 3) the induction of mispairing of the nucleotides leading to mutations. |
Organisms_affected: | Humans and other mammals |